![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | Rocket Equation Derivation.png | 2018-08-21 09:14 | 3.7M | |
![[ ]](/icons/layout.gif) | Electric Propulsion 1.pdf | 2018-08-21 09:14 | 1.0M | |
![[ ]](/icons/layout.gif) | Nuclear Propulsion 1.pdf | 2018-08-21 09:14 | 779K | |
![[ ]](/icons/layout.gif) | Electric Propulsion 2.pdf | 2018-08-21 09:14 | 731K | |
![[ ]](/icons/layout.gif) | Nuclear Propulsion 2.pdf | 2018-08-21 09:14 | 713K | |
![[ ]](/icons/layout.gif) | Chemical Rockets Design - Propellant Injection.pdf | 2018-08-21 09:14 | 550K | |
![[ ]](/icons/layout.gif) | SKYLON - CASE STUDY.pdf | 2018-08-21 09:14 | 541K | |
![[ ]](/icons/layout.gif) | Launchers 3 - Multiple Stages.pdf | 2018-08-21 09:14 | 509K | |
![[ ]](/icons/layout.gif) | Chemical Rockets Design - Coolling.pdf | 2018-08-21 09:14 | 470K | |
![[ ]](/icons/layout.gif) | Launchers 2 -Getting to Orbit.pdf | 2018-08-21 09:14 | 465K | |
![[ ]](/icons/layout.gif) | Reusable Launchers 1.pdf | 2018-08-21 09:14 | 428K | |
![[ ]](/icons/layout.gif) | Launchers 1 - Propellant Injection.pdf | 2018-08-21 09:14 | 417K | |
![[ ]](/icons/layout.gif) | 3-Chemical Rockets.pdf | 2018-08-21 09:14 | 396K | |
![[ ]](/icons/layout.gif) | 1-Rocket Equation.pdf | 2018-08-21 09:14 | 292K | |
![[ ]](/icons/layout.gif) | 2-Specific Impulse and Efficiency.pdf | 2018-08-21 09:14 | 188K | |
![[ ]](/icons/layout.gif) | e-mail Carlos Libero 2018-08-09.pdf | 2018-08-21 09:15 | 90K | |
|